CAS 614-23-3 appears in our catalog under these names: N–Benzoylthiourea, N-Benzoylthiourea, 98% , N-Benzoylthiourea, N-Benzoylthiourea, >98.0%(HPLC)(N), N-Carbamothioylbenzamide, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Chemat. Available pack sizes: 100g, 25g, 5g, 50g, 250g, 500g, 1g, 10g.
N-carbamothioylbenzamide (CAS 614-23-3) is a chemical compound with the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. IUPAC name: N-carbamothioylbenzamide. InChIKey: DQMWMUMCNOJLSI-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS |
|---|---|
| Molecular weight | 180.23 g/mol |
| IUPAC name | N-carbamothioylbenzamide |
| InChIKey | DQMWMUMCNOJLSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)N |
Computed by PubChem (NCBI)