CAS 80393-37-9 appears in our catalog under these names: 4-(Aminocarbonothioyl)benzamide, 95%, 4-Carbamothioylbenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-carbamothioylbenzamide (CAS 80393-37-9) is a chemical compound with the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. IUPAC name: 4-carbamothioylbenzamide. InChIKey: SFZWPDVFJRWAAO-UHFFFAOYSA-N.
| Molecular formula | C8H8N2OS |
|---|---|
| Molecular weight | 180.23 g/mol |
| IUPAC name | 4-carbamothioylbenzamide |
| InChIKey | SFZWPDVFJRWAAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)C(=S)N |
Computed by PubChem (NCBI)