cas: 1005500-75-3 — see every product listed under this CAS number, including other names
N-(Methyl)-N-(p-toluenesulfonyl)ethynylamine, 98%, 98% (CAS 1005500-75-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1113AT-10g |
| cas | 1005500-75-3 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 266.00 Pln | |
| Chemat | 100mg | 69.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 530.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-ethynyl-N,4-dimethylbenzenesulfonamide (CAS 1005500-75-3) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: N-ethynyl-N,4-dimethylbenzenesulfonamide. InChIKey: VRNLIJIYOKNEOP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | N-ethynyl-N,4-dimethylbenzenesulfonamide |
| InChIKey | VRNLIJIYOKNEOP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C)C#C |
Computed by PubChem (NCBI)