cas: 261767-16-2 — see every product listed under this CAS number, including other names
N-(Piperidin-4-ylmethyl)-2,3-dihydrobenzo(b)(1,4)dioxine-5-carboxamide hydrochloride, 97% (CAS 261767-16-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A795239-5g |
| cas | 261767-16-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8533.00 Pln | |
| AmBeed | 25g | 25543.63 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-(piperidin-4-ylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide;hydrochloride (CAS 261767-16-2) is a chemical compound with the molecular formula C15H21ClN2O3 and a molecular weight of 312.79 g/mol. IUPAC name: N-(piperidin-4-ylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide;hydrochloride. InChIKey: LRYJLOBWOQHQCI-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O3 |
|---|---|
| Molecular weight | 312.79 g/mol |
| IUPAC name | N-(piperidin-4-ylmethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide;hydrochloride |
| InChIKey | LRYJLOBWOQHQCI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CNC(=O)C2=C3C(=CC=C2)OCCO3.Cl |
Computed by PubChem (NCBI)