CAS 871339-84-3 is the registry number for tert-butyl 4-(3-chloro-5-hydroxyphenyl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 4-(3-chloro-5-hydroxyphenyl)piperazine-1-carboxylate (CAS 871339-84-3) is a chemical compound with the molecular formula C15H21ClN2O3 and a molecular weight of 312.79 g/mol. IUPAC name: tert-butyl 4-(3-chloro-5-hydroxyphenyl)piperazine-1-carboxylate. InChIKey: MEWOBLVNZZJSKF-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O3 |
|---|---|
| Molecular weight | 312.79 g/mol |
| IUPAC name | tert-butyl 4-(3-chloro-5-hydroxyphenyl)piperazine-1-carboxylate |
| InChIKey | MEWOBLVNZZJSKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=CC(=C2)Cl)O |
Computed by PubChem (NCBI)