N-(p-Tolyl)naphthalen-1-amine, 95+%
cas: 634-43-5 — see every product listed under this CAS number, including other names
N-(p-Tolyl)naphthalen-1-amine, 95+% (CAS 634-43-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A727206-250mg |
| cas | 634-43-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1232.56 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1346.00 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 414.32 Pln | |
| BLDpharm | 5g | 1325.11 Pln | |
| Fluorochem | 1g | 679.99 Pln | |
| Fluorochem | 5g | 2497.05 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
N-(4-methylphenyl)naphthalen-1-amine (CAS 634-43-5) is a chemical compound with the molecular formula C17H15N and a molecular weight of 233.31 g/mol. IUPAC name: N-(4-methylphenyl)naphthalen-1-amine. InChIKey: RWYRKFWBKGQTLU-UHFFFAOYSA-N.
| Molecular formula | C17H15N |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | N-(4-methylphenyl)naphthalen-1-amine |
| InChIKey | RWYRKFWBKGQTLU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)