Products 226066-81-5
CAS 226066-81-5 is the registry number for 4-Phenyl-1,2,3,4-tetrahydrocyclopent(b)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
4-phenyl-2,3-dihydro-1H-cyclopenta[b]indole (CAS 226066-81-5) is a chemical compound with the molecular formula C17H15N and a molecular weight of 233.31 g/mol. IUPAC name: 4-phenyl-2,3-dihydro-1H-cyclopenta[b]indole. InChIKey: JZQZATJZVUWISV-UHFFFAOYSA-N.
| Molecular formula | C17H15N |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 4-phenyl-2,3-dihydro-1H-cyclopenta[b]indole |
| InChIKey | JZQZATJZVUWISV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(C3=CC=CC=C23)C4=CC=CC=C4 |
Computed by PubChem (NCBI)