cas: 1133115-34-0 — see every product listed under this CAS number, including other names
N-(tert-Butyl)-5-fluoro-2-nitroaniline 96% (CAS 1133115-34-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277751-1g |
| cas | 1133115-34-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 681.88 Pln | |
| Ambeed | 25g | 2211.56 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A277751 |
N-tert-butyl-5-fluoro-2-nitroaniline (CAS 1133115-34-0) is a chemical compound with the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. IUPAC name: N-tert-butyl-5-fluoro-2-nitroaniline. InChIKey: PDPODKJJJYTBIM-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O2 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | N-tert-butyl-5-fluoro-2-nitroaniline |
| InChIKey | PDPODKJJJYTBIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)