CAS 432495-25-5 is the registry number for N,N-diethyl-4-fluoro-2-nitroaniline, 92%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
N,N-diethyl-4-fluoro-2-nitroaniline (CAS 432495-25-5) is a chemical compound with the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. IUPAC name: N,N-diethyl-4-fluoro-2-nitroaniline. InChIKey: AWZGFXLNXUERQT-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O2 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | N,N-diethyl-4-fluoro-2-nitroaniline |
| InChIKey | AWZGFXLNXUERQT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)