cas: 51072-34-5 — see every product listed under this CAS number, including other names
N-[2-(1-Cyclohexen-1-yl)ethyl]-4-methoxybenzeneacetamide, 97%, 97% (CAS 51072-34-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E2LD-250mg |
| cas | 51072-34-5 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 25g | 1211.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-[2-(cyclohexen-1-yl)ethyl]-2-(4-methoxyphenyl)acetamide (CAS 51072-34-5) is a chemical compound with the molecular formula C17H23NO2 and a molecular weight of 273.37 g/mol. IUPAC name: N-[2-(cyclohexen-1-yl)ethyl]-2-(4-methoxyphenyl)acetamide. InChIKey: QIXKSRMRGXDDEH-UHFFFAOYSA-N.
| Molecular formula | C17H23NO2 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-methoxyphenyl)acetamide |
| InChIKey | QIXKSRMRGXDDEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC(=O)NCCC2=CCCCC2 |
Computed by PubChem (NCBI)