cas: 480444-15-3 — see every product listed under this CAS number, including other names
N-[2-[(4S)-4,5-Dihydro-4-(1-methylethyl)-2-oxazolyl]-6-methylphenyl]methanesulfonamide, 98%, 98% (CAS 480444-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JS1R-100mg |
| cas | 480444-15-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1715.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[2-methyl-6-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]methanesulfonamide (CAS 480444-15-3) is a chemical compound with the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. IUPAC name: N-[2-methyl-6-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]methanesulfonamide. InChIKey: KCLDECJIUSCXOX-GFCCVEGCSA-N.
| Molecular formula | C14H20N2O3S |
|---|---|
| Molecular weight | 296.39 g/mol |
| IUPAC name | N-[2-methyl-6-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]methanesulfonamide |
| InChIKey | KCLDECJIUSCXOX-GFCCVEGCSA-N |
| SMILES | CC1=C(C(=CC=C1)C2=N[C@H](CO2)C(C)C)NS(=O)(=O)C |
Computed by PubChem (NCBI)