cas: 156939-69-4 — see every product listed under this CAS number, including other names
N-[2-[[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino]Ethyl]Glycine Methyl Ester, 97%, 97% (CAS 156939-69-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DNDE-250mg |
| cas | 156939-69-4 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1480.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetate (CAS 156939-69-4) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: methyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetate. InChIKey: SUUIECYTKGRQCI-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | methyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetate |
| InChIKey | SUUIECYTKGRQCI-UHFFFAOYSA-N |
| SMILES | COC(=O)CNCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)