cas: 156939-69-4 — see every product listed under this CAS number, including other names
Fmoc-Aeg-OMe 95% (CAS 156939-69-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123939-250mg |
| cas | 156939-69-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 1972.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A123939 |
Methyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetate (CAS 156939-69-4) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: methyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetate. InChIKey: SUUIECYTKGRQCI-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | methyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetate |
| InChIKey | SUUIECYTKGRQCI-UHFFFAOYSA-N |
| SMILES | COC(=O)CNCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)