cas: 935660-75-6 — see every product listed under this CAS number, including other names
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide, 95%, 95% (CAS 935660-75-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3RU-100mg |
| cas | 935660-75-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1077.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (CAS 935660-75-6) is a chemical compound with the molecular formula C19H22BNO3 and a molecular weight of 323.2 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide. InChIKey: BRERQYZGASSZJR-UHFFFAOYSA-N.
| Molecular formula | C19H22BNO3 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| InChIKey | BRERQYZGASSZJR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)