CAS 17282-41-6 appears in our catalog under these names: 1-(2-Oxopropyl)pyridin-1-ium bromide, 98%, N-Acetonylpyridinium bromide/ 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10g.
1-pyridin-1-ium-1-ylpropan-2-one bromide (CAS 17282-41-6) is a chemical compound with the molecular formula C8H10BrNO and a molecular weight of 216.07 g/mol. IUPAC name: 1-pyridin-1-ium-1-ylpropan-2-one bromide. InChIKey: RBFIDROZWYVUGX-UHFFFAOYSA-M.
| Molecular formula | C8H10BrNO |
|---|---|
| Molecular weight | 216.07 g/mol |
| IUPAC name | 1-pyridin-1-ium-1-ylpropan-2-one bromide |
| InChIKey | RBFIDROZWYVUGX-UHFFFAOYSA-M |
| SMILES | CC(=O)C[N+]1=CC=CC=C1.[Br-] |
Computed by PubChem (NCBI)