cas: 1811-31-0 — see every product listed under this CAS number, including other names
N-Acetyl-D-galactosamine, 98% (CAS 1811-31-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Thermo Scientific (Acros), Chemat.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 434920010 |
| cas | 1811-31-0 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 939.89 Pln | |
| Thermo Scientific (Acros) | 5g | 2975.57 Pln | |
| Chemat | 10g | 251.60 Pln | |
| Chemat | 25g | 534.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 1g | 83.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
N-acetyl-D-galactosamine is the D-enantiomer of N-acetylgalactosamine. It has a role as a mouse metabolite, an Escherichia coli metabolite and a human metabolite. It is a N-acetyl-D-hexosamine and a N-acetylgalactosamine.
Source: ChEBI
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| InChIKey | OVRNDRQMDRJTHS-KEWYIRBNSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](OC1O)CO)O)O |
Computed by PubChem (NCBI)