Products 77369-11-0
CAS 77369-11-0 appears in our catalog under these names: N-Acetyl-D-glucosamine-d3, >95% (HPLC), N–Acetyl–D–glucosamine–d3, N-Acetyl-D-glucosamine-d3. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg, 100 mg, 10 mg.
2,2,2-trideuterio-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (CAS 77369-11-0) is a chemical compound with the molecular formula C8H15NO6 and a molecular weight of 224.23 g/mol. IUPAC name: 2,2,2-trideuterio-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide. InChIKey: OVRNDRQMDRJTHS-OSEDBHPGSA-N.
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| InChIKey | OVRNDRQMDRJTHS-OSEDBHPGSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1O)CO)O)O |
Computed by PubChem (NCBI)