cas: 102029-88-9 — see every product listed under this CAS number, including other names
N-Acetyl-D-galactosamine-6-phosphate disodium 98% (CAS 102029-88-9) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2867673-5mg |
| cas | 102029-88-9 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 576.19 Pln | |
| Ambeed | 10mg | 843.19 Pln | |
| Ambeed | 25mg | 1371.62 Pln | |
| Ambeed | 50mg | 2322.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2867673 |
Sodium [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate (CAS 102029-88-9) is a chemical compound with the molecular formula C8H15NNaO9P and a molecular weight of 323.17 g/mol. IUPAC name: sodium [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate. InChIKey: GFIDKAUZPGVSRH-FROKLYQUSA-M.
| Molecular formula | C8H15NNaO9P |
|---|---|
| Molecular weight | 323.17 g/mol |
| IUPAC name | sodium [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate |
| InChIKey | GFIDKAUZPGVSRH-FROKLYQUSA-M |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1O)COP(=O)(O)[O-])O)O.[Na+] |
Computed by PubChem (NCBI)