CAS 102029-88-9 appears in our catalog under these names: N-Acetyl-d-glucosamine-6-phosphate disodium salt, 95%, N–Acetyl–D–glucosamine 6–phosphate disodium salt, N-Acetyl-D-glucosamine 6-phosphate disodium salt, 98.00%, N-Acetyl-D-glucosamine-6-phosphate disodium, N-Acetyl-D-galactosamine-6-phosphate disodium 98%. Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 25mg, 10mg, 50mg, 500mg, 1000mg.
Sodium [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate (CAS 102029-88-9) is a chemical compound with the molecular formula C8H15NNaO9P and a molecular weight of 323.17 g/mol. IUPAC name: sodium [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate. InChIKey: GFIDKAUZPGVSRH-FROKLYQUSA-M.
| Molecular formula | C8H15NNaO9P |
|---|---|
| Molecular weight | 323.17 g/mol |
| IUPAC name | sodium [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl hydrogen phosphate |
| InChIKey | GFIDKAUZPGVSRH-FROKLYQUSA-M |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1O)COP(=O)(O)[O-])O)O.[Na+] |
Computed by PubChem (NCBI)