cas: 17916-88-0 — see every product listed under this CAS number, including other names
N-Acetyl-D-valine, >98.0%(T) (CAS 17916-88-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0678-1G |
| cas | 17916-88-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 369.12 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(2R)-2-acetamido-3-methylbutanoic acid (CAS 17916-88-0) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: (2R)-2-acetamido-3-methylbutanoic acid. InChIKey: IHYJTAOFMMMOPX-ZCFIWIBFSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | (2R)-2-acetamido-3-methylbutanoic acid |
| InChIKey | IHYJTAOFMMMOPX-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)