cas: 17916-88-0 — see every product listed under this CAS number, including other names
N-Acetyl-D-valine, 97.0% (CAS 17916-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W015465-100 g |
| cas | 17916-88-0 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 872.33 Pln | |
| MedChemExpress | 25 g | 366.13 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
(2R)-2-acetamido-3-methylbutanoic acid (CAS 17916-88-0) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: (2R)-2-acetamido-3-methylbutanoic acid. InChIKey: IHYJTAOFMMMOPX-ZCFIWIBFSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | (2R)-2-acetamido-3-methylbutanoic acid |
| InChIKey | IHYJTAOFMMMOPX-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)