cas: 27486-87-9 — see every product listed under this CAS number, including other names
N-Acetyl-S-trityl-L-cysteine, 98% (CAS 27486-87-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F862490-5G |
| cas | 27486-87-9 |
| size | 5g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 227.02 Pln | |
| Fluorochem | 100g | 726.85 Pln | |
| Fluorochem | 500g | 3090.60 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 419.60 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2R)-2-acetamido-3-tritylsulfanylpropanoic acid (CAS 27486-87-9) is a chemical compound with the molecular formula C24H23NO3S and a molecular weight of 405.5 g/mol. IUPAC name: (2R)-2-acetamido-3-tritylsulfanylpropanoic acid. InChIKey: KCVPASSMLHHOIF-QFIPXVFZSA-N.
| Molecular formula | C24H23NO3S |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | (2R)-2-acetamido-3-tritylsulfanylpropanoic acid |
| InChIKey | KCVPASSMLHHOIF-QFIPXVFZSA-N |
| SMILES | CC(=O)N[C@@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)