cas: 188527-08-4 — see every product listed under this CAS number, including other names
N-Benzyl 1-Boc-piperidine-4-carboxamide, 98%, 98% (CAS 188527-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQIT-1g |
| cas | 188527-08-4 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 856.40 Pln | |
| Chemat | 100mg | 83.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(benzylcarbamoyl)piperidine-1-carboxylate (CAS 188527-08-4) is a chemical compound with the molecular formula C18H26N2O3 and a molecular weight of 318.4 g/mol. IUPAC name: tert-butyl 4-(benzylcarbamoyl)piperidine-1-carboxylate. InChIKey: AGQWIWVWFLIEKQ-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | tert-butyl 4-(benzylcarbamoyl)piperidine-1-carboxylate |
| InChIKey | AGQWIWVWFLIEKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)