Products 1423037-55-1

CAS 1423037-55-1 is the registry number for N-Cyclopentyl L-Z-Valinamide, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl]carbamate (CAS 1423037-55-1) is a chemical compound with the molecular formula C18H26N2O3 and a molecular weight of 318.4 g/mol. IUPAC name: benzyl N-[1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: IAVPTJMDULLLRT-UHFFFAOYSA-N.

Identity
Molecular formulaC18H26N2O3
Molecular weight318.4 g/mol
IUPAC namebenzyl N-[1-(cyclopentylamino)-3-methyl-1-oxobutan-2-yl]carbamate
InChIKeyIAVPTJMDULLLRT-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)NC1CCCC1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)