cas: 3193-62-2 — see every product listed under this CAS number, including other names
N-Benzyl-1-phenylethanamine 98% (CAS 3193-62-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A967597-100g |
| cas | 3193-62-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 793.12 Pln | |
| Ambeed | 25g | 292.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A967597 |
N-benzyl-1-phenylethanamine (CAS 3193-62-2) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: N-benzyl-1-phenylethanamine. InChIKey: ZYZHMSJNPCYUTB-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | N-benzyl-1-phenylethanamine |
| InChIKey | ZYZHMSJNPCYUTB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)