cas: 7461-34-9 — see every product listed under this CAS number, including other names
N-Benzyl-4-chlorobenzamide 95% (CAS 7461-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A730584-100mg |
| cas | 7461-34-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1955.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A730584 |
N-benzyl-4-chlorobenzamide (CAS 7461-34-9) is a chemical compound with the molecular formula C14H12ClNO and a molecular weight of 245.70 g/mol. IUPAC name: N-benzyl-4-chlorobenzamide. InChIKey: LSMWDKIFKGLNSW-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | N-benzyl-4-chlorobenzamide |
| InChIKey | LSMWDKIFKGLNSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)