CAS 5110-77-0 appears in our catalog under these names: 2-Chloro-n,2-diphenylacetamide, 95%, 2-Chloro-N,2-diphenylacetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N,2-diphenylacetamide (CAS 5110-77-0) is a chemical compound with the molecular formula C14H12ClNO and a molecular weight of 245.70 g/mol. IUPAC name: 2-chloro-N,2-diphenylacetamide. InChIKey: FMADJSSGSBCKGZ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 2-chloro-N,2-diphenylacetamide |
| InChIKey | FMADJSSGSBCKGZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)NC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)