cas: 3987-53-9 — see every product listed under this CAS number, including other names
N-Benzyliminodiacetic Acid, 95%, 95% (CAS 3987-53-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SS1-100mg |
| cas | 3987-53-9 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 866.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[benzyl(carboxymethyl)amino]acetic acid (CAS 3987-53-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-[benzyl(carboxymethyl)amino]acetic acid. InChIKey: SZQUPQVVCLFZLC-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-[benzyl(carboxymethyl)amino]acetic acid |
| InChIKey | SZQUPQVVCLFZLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)