N-Benzylnaphthalen-2-amine, 98%
cas: 13672-18-9 — see every product listed under this CAS number, including other names
N-Benzylnaphthalen-2-amine, 98% (CAS 13672-18-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A363031-250mg |
| cas | 13672-18-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 25g | 1649.75 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 650.00 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 25g | 1774.96 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 726.85 Pln | |
| Fluorochem | 25g | 1695.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
N-benzylnaphthalen-2-amine (CAS 13672-18-9) is a chemical compound with the molecular formula C17H15N and a molecular weight of 233.31 g/mol. IUPAC name: N-benzylnaphthalen-2-amine. InChIKey: KBOITYDYBXNTMF-UHFFFAOYSA-N.
| Molecular formula | C17H15N |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | N-benzylnaphthalen-2-amine |
| InChIKey | KBOITYDYBXNTMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)