cas: 2717-76-2 — see every product listed under this CAS number, including other names
N-Benzyloxycarbonyl-L-tryptophan methyl ester, 95%, 95% (CAS 2717-76-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 25g, 100g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ACK-250mg |
| cas | 2717-76-2 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 376.40 Pln | |
| Chemat | 5g | 88.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 2717-76-2) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: methyl (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: DYWXSVJXETXGGQ-SFHVURJKSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | methyl (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | DYWXSVJXETXGGQ-SFHVURJKSA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)