N-Boc-L-lysine methyl ester hydrochloride, 98%
cas: 2389-48-2 — see every product listed under this CAS number, including other names
N-Boc-L-lysine methyl ester hydrochloride, 98% (CAS 2389-48-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140HL-250mg |
| cas | 2389-48-2 |
| size | 250mg |
| availability | 681.85g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 50g | 381.20 Pln | |
| Chemat | 100g | 669.20 Pln | |
| Chemat | 250g | 1475.60 Pln | |
| Chemat | 500g | 2606.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride (CAS 2389-48-2) is a chemical compound with the molecular formula C12H25ClN2O4 and a molecular weight of 296.79 g/mol. IUPAC name: methyl (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride. InChIKey: NANRHOPPXCBHGI-FVGYRXGTSA-N.
| Molecular formula | C12H25ClN2O4 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | methyl (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride |
| InChIKey | NANRHOPPXCBHGI-FVGYRXGTSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Lys(Boc)-OMe.HCl, H-Lys(Boc)-OMe hydrochloride, H-LYS(BOC)-OME HCL, N-Boc-L-lysine methyl ester hydrochloride, Lys(Boc)-OMe.HCl, methyl N6-(tert-butoxycarbonyl)-L-lysinate hydrochloride, H-Lys(Boc)OMe hydrochloride, C12H25ClN2O4, (S)-Methyl 2-amino-6-((tert-butoxycarbonyl)amino)hexanoate hydrochloride, Nepsilon-Boc-L-lysine methyl ester hydrochloride