cas: 1797171-55-1 — see every product listed under this CAS number, including other names
N-Carbamimidoylpyrazine-2-carboxamide dihydrochloride, 98% (CAS 1797171-55-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1045726-5g |
| cas | 1797171-55-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18688.60 Pln | |
| AmBeed | 10g | 22601.11 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-(diaminomethylidene)pyrazine-2-carboxamide;dihydrochloride (CAS 1797171-55-1) is a chemical compound with the molecular formula C6H9Cl2N5O and a molecular weight of 238.07 g/mol. IUPAC name: N-(diaminomethylidene)pyrazine-2-carboxamide;dihydrochloride. InChIKey: QRYNBQMFGIFDAV-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl2N5O |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | N-(diaminomethylidene)pyrazine-2-carboxamide;dihydrochloride |
| InChIKey | QRYNBQMFGIFDAV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C(=O)N=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)