CAS 1797171-55-1 appears in our catalog under these names: N-Carbamimidoylpyrazine-2-carboxamide dihydrochloride, 95%, N-Carbamimidoylpyrazine-2-carboxamide dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
N-(diaminomethylidene)pyrazine-2-carboxamide;dihydrochloride (CAS 1797171-55-1) is a chemical compound with the molecular formula C6H9Cl2N5O and a molecular weight of 238.07 g/mol. IUPAC name: N-(diaminomethylidene)pyrazine-2-carboxamide;dihydrochloride. InChIKey: QRYNBQMFGIFDAV-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl2N5O |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | N-(diaminomethylidene)pyrazine-2-carboxamide;dihydrochloride |
| InChIKey | QRYNBQMFGIFDAV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C(=O)N=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)