CAS 24583-23-1 appears in our catalog under these names: N-Carbamoyl-L-cysteine, >95% (HPLC), N-Carbamoyl-L-cysteine, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 500mg, 100mg, 250mg.
N-carbamoyl-L-cysteine is a cysteine derivative that is the N-carbamoyl derivative of L-cysteine. It has a role as an antifungal agent and a cosmetic. It is a conjugate acid of a N-carbamoyl-L-cysteinate(1-).
Source: ChEBI
| Molecular formula | C4H8N2O3S |
|---|---|
| Molecular weight | 164.19 g/mol |
| IUPAC name | (2R)-2-(carbamoylamino)-3-sulfanylpropanoic acid |
| InChIKey | APFSAMXTZRYBKF-REOHCLBHSA-N |
| SMILES | C([C@@H](C(=O)O)NC(=O)N)S |
Computed by PubChem (NCBI)