cas: 286961-15-7 — see every product listed under this CAS number, including other names
N-Cbz-1,2,3,6-tetrahydropyridine-4-boronic acid pinacol ester, 98.59% (CAS 286961-15-7) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 50 g, 25 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-32685-100 g |
| cas | 286961-15-7 |
| size | 100 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 1513.20 Pln | |
| MedChemExpress | 50 g | 858.40 Pln | |
| MedChemExpress | 25 g | 542.60 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10 g | 310.40 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 98.59% |
Benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 286961-15-7) is a chemical compound with the molecular formula C19H26BNO4 and a molecular weight of 343.2 g/mol. IUPAC name: benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: QDSFHRPYZPQWEJ-UHFFFAOYSA-N.
| Molecular formula | C19H26BNO4 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | QDSFHRPYZPQWEJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCN(CC2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)