CAS 2281870-44-6 is the registry number for tert-Butyl 7-(tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 2281870-44-6) is a chemical compound with the molecular formula C19H26BNO4 and a molecular weight of 343.2 g/mol. IUPAC name: tert-butyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: DUPDKCCGBOSLEE-UHFFFAOYSA-N.
| Molecular formula | C19H26BNO4 |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | tert-butyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | DUPDKCCGBOSLEE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=CN3C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)