cas: 933987-10-1 — see every product listed under this CAS number, including other names
N-Cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%,RG, 95%,RG (CAS 933987-10-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H2TA-250mg |
| cas | 933987-10-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1101.20 Pln |
| purity | 95%,RG |
|---|---|
| delivery time | 3 weeks |
N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 933987-10-1) is a chemical compound with the molecular formula C18H26BNO3 and a molecular weight of 315.2 g/mol. IUPAC name: N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: ZEYNCUYCJKNKER-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO3 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | ZEYNCUYCJKNKER-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NC3CCCC3 |
Computed by PubChem (NCBI)