cas: 88229-16-7 — see every product listed under this CAS number, including other names
N-Cyclopropyl 4-fluorobenzamide, 98%, 98% (CAS 88229-16-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SXK-5g |
| cas | 88229-16-7 |
| size | 5g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-4-fluorobenzamide (CAS 88229-16-7) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: N-cyclopropyl-4-fluorobenzamide. InChIKey: YPSPTZQFKWMPDX-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | N-cyclopropyl-4-fluorobenzamide |
| InChIKey | YPSPTZQFKWMPDX-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)