cas: 16357-59-8 — see every product listed under this CAS number, including other names
N-Ethoxycarbonyl-2-ethoxy-1,2-dihydroquinoline, 95% (CAS 16357-59-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F003625-10G |
| cas | 16357-59-8 |
| size | 10g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 250g | 367.60 Pln | |
| Fluorochem | 500g | 648.75 Pln | |
| Fluorochem | 1kg | 1044.44 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Ethyl 2-ethoxy-2H-quinoline-1-carboxylate (CAS 16357-59-8) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: ethyl 2-ethoxy-2H-quinoline-1-carboxylate. InChIKey: GKQLYSROISKDLL-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | ethyl 2-ethoxy-2H-quinoline-1-carboxylate |
| InChIKey | GKQLYSROISKDLL-UHFFFAOYSA-N |
| SMILES | CCOC1C=CC2=CC=CC=C2N1C(=O)OCC |
Computed by PubChem (NCBI)