Products 1207194-48-6
CAS 1207194-48-6 appears in our catalog under these names: 1-Boc-4-formylindoline, 95%, 1-Boc-4-formylindoline 97%, tert-Butyl 4-formylindoline-1-carboxylate, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
Tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate (CAS 1207194-48-6) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate. InChIKey: FEAIDQMPFVVRKA-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate |
| InChIKey | FEAIDQMPFVVRKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C=CC=C21)C=O |
Computed by PubChem (NCBI)