cas: 3665-80-3 — see every product listed under this CAS number, including other names
N-Ethyl-4-nitroaniline, 98%, 98% (CAS 3665-80-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SZY-250mg |
| cas | 3665-80-3 |
| size | 250mg |
| availability | 80g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 280.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-ethyl-4-nitroaniline (CAS 3665-80-3) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N-ethyl-4-nitroaniline. InChIKey: XBNNLAWQCMDISJ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N-ethyl-4-nitroaniline |
| InChIKey | XBNNLAWQCMDISJ-UHFFFAOYSA-N |
| SMILES | CCNC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)