cas: 111061-55-3 — see every product listed under this CAS number, including other names
N-Fmoc-O-trityl-L-homoserine, 95% (CAS 111061-55-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145XW-100mg |
| cas | 111061-55-3 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1235.60 Pln | |
| Chemat | 25g | 2958.80 Pln | |
| Chemat | 50g | 4850.00 Pln | |
| Chemat | 100g | 8915.60 Pln | |
| Chemat | 250g | 16298.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-trityloxybutanoic acid (CAS 111061-55-3) is a chemical compound with the molecular formula C38H33NO5 and a molecular weight of 583.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-trityloxybutanoic acid. InChIKey: QUTREFXHXPNEJN-DHUJRADRSA-N.
| Molecular formula | C38H33NO5 |
|---|---|
| Molecular weight | 583.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-trityloxybutanoic acid |
| InChIKey | QUTREFXHXPNEJN-DHUJRADRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)