cas: 56935-74-1 — see every product listed under this CAS number, including other names
N-HYDROXY-4-(METHYLSULFONYL)BENZENECARBOXIMIDAMIDE (CAS 56935-74-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305576-1G |
| cas | 56935-74-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 752.88 Pln | |
| Fluorochem | 5g | 2866.72 Pln |
| delivery time | 2-3 weeks |
|---|
N'-hydroxy-4-methylsulfonylbenzenecarboximidamide (CAS 56935-74-1) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: N'-hydroxy-4-methylsulfonylbenzenecarboximidamide. InChIKey: ASVKDPCGOIIZIN-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | N'-hydroxy-4-methylsulfonylbenzenecarboximidamide |
| InChIKey | ASVKDPCGOIIZIN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=NO)N |
Computed by PubChem (NCBI)