cas: 904326-88-1 — see every product listed under this CAS number, including other names
N-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine 98% (CAS 904326-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A847562-100mg |
| cas | 904326-88-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 3134.94 Pln | |
| Ambeed | 25g | 10794.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A847562 |
N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 904326-88-1) is a chemical compound with the molecular formula C11H18BN3O2 and a molecular weight of 235.09 g/mol. IUPAC name: N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: QDOXNCAIXITTKA-UHFFFAOYSA-N.
| Molecular formula | C11H18BN3O2 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | QDOXNCAIXITTKA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NC |
Computed by PubChem (NCBI)