cas: 875917-19-4 — see every product listed under this CAS number, including other names
N-Methyl-N-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanesulfonamide 95% (CAS 875917-19-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A418336-250mg |
| cas | 875917-19-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1727.62 Pln | |
| Ambeed | 5g | 5905.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A418336 |
N-methyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (CAS 875917-19-4) is a chemical compound with the molecular formula C14H22BNO4S and a molecular weight of 311.2 g/mol. IUPAC name: N-methyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide. InChIKey: SUHYFNZXTRHOFB-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4S |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | N-methyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| InChIKey | SUHYFNZXTRHOFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N(C)S(=O)(=O)C |
Computed by PubChem (NCBI)