N-Methylcytisine, 98%
cas: 486-86-2 — see every product listed under this CAS number, including other names
N-Methylcytisine, 98% (CAS 486-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 1mg, 5mg, 10mg, 50mg. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A900570-100mg |
| cas | 486-86-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1126.88 Pln | |
| Ambeed | 250mg | 1866.69 Pln | |
| Ambeed | 1g | 6516.94 Pln | |
| Chemat | 1mg | 174.80 Pln | |
| Chemat | 5mg | 347.60 Pln | |
| Chemat | 10mg | 621.20 Pln | |
| Chemat | 50mg | 731.60 Pln | |
| Chemat | 100mg | 1202.00 Pln | |
| Chemat | 250mg | 1994.00 Pln | |
| Fluorochem | 50mg | 1351.62 Pln | |
| Fluorochem | 250mg | 3684.14 Pln | |
| Fluorochem | 5mg | 633.13 Pln | |
| Fluorochem | 100mg | 2231.52 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(1R,9S)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (CAS 486-86-2) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: (1R,9S)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one. InChIKey: CULUKMPMGVXCEI-VHSXEESVSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | (1R,9S)-11-methyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| InChIKey | CULUKMPMGVXCEI-VHSXEESVSA-N |
| SMILES | CN1C[C@@H]2C[C@H](C1)C3=CC=CC(=O)N3C2 |
Computed by PubChem (NCBI)