N-Phenyl-4-(pyridin-3-yl)aniline, 98%
cas: 1448787-63-0 — see every product listed under this CAS number, including other names
N-Phenyl-4-(pyridin-3-yl)aniline, 98% (CAS 1448787-63-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1214164-1g |
| cas | 1448787-63-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 759.75 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 25g | 814.18 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 837.20 Pln | |
| Fluorochem | 25g | 1554.68 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 508.17 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N-phenyl-4-pyridin-3-ylaniline (CAS 1448787-63-0) is a chemical compound with the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. IUPAC name: N-phenyl-4-pyridin-3-ylaniline. InChIKey: BXOMRKCAPYLLAC-UHFFFAOYSA-N.
| Molecular formula | C17H14N2 |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | N-phenyl-4-pyridin-3-ylaniline |
| InChIKey | BXOMRKCAPYLLAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)