cas: 19525-59-8 — see every product listed under this CAS number, including other names
N-Phenylglycine potassium salt, 95%, 95% (CAS 19525-59-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TBB-1g |
| cas | 19525-59-8 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 765.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Potassium 2-anilinoacetate (CAS 19525-59-8) is a chemical compound with the molecular formula C8H8KNO2 and a molecular weight of 189.25 g/mol. IUPAC name: potassium 2-anilinoacetate. InChIKey: JINONCVJYBHUCP-UHFFFAOYSA-M.
| Molecular formula | C8H8KNO2 |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | potassium 2-anilinoacetate |
| InChIKey | JINONCVJYBHUCP-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)NCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)