CAS 19525-59-8 appears in our catalog under these names: N-Phenylglycine potassium salt, 98%, N–Phenylglycine potassium salt, N-Phenylglycine potassium salt, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
Potassium 2-anilinoacetate (CAS 19525-59-8) is a chemical compound with the molecular formula C8H8KNO2 and a molecular weight of 189.25 g/mol. IUPAC name: potassium 2-anilinoacetate. InChIKey: JINONCVJYBHUCP-UHFFFAOYSA-M.
| Molecular formula | C8H8KNO2 |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | potassium 2-anilinoacetate |
| InChIKey | JINONCVJYBHUCP-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)NCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)