cas: 153290-82-5 — see every product listed under this CAS number, including other names
N-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide, 98%, 98% (CAS 153290-82-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IOQI-100mg |
| cas | 153290-82-5 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 2306.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (CAS 153290-82-5) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: N-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide. InChIKey: DMJXRYSGXCLCFP-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | N-tert-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| InChIKey | DMJXRYSGXCLCFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1CC2=CC=CC=C2CN1 |
Computed by PubChem (NCBI)